C22H28N2O2 — CID 158287072
4-butan-2-yl-N-(2-hydroxyphenyl)benzamide;2-methylbutanenitrile (PubChem CID 158287072) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 4-butan-2-yl-N-(2-hydroxyphenyl)benzamide;2-methylbutanenitrile.
| Compound Name | 4-butan-2-yl-N-(2-hydroxyphenyl)benzamide;2-methylbutanenitrile |
|---|---|
| PubChem CID | 158287072 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 4-butan-2-yl-N-(2-hydroxyphenyl)benzamide;2-methylbutanenitrile |
| SMILES | CCC(C)C#N.CCC(C)c1ccc(C(=O)Nc2ccccc2O)cc1 |
| InChI | InChI=1S/C17H19NO2.C5H9N/c1-3-12(2)13-8-10-14(11-9-13)17(20)18-15-6-4-5-7-16(15)19;1-3-5(2)4-6/h4-12,19H,3H2,1-2H3,(H,18,20);5H,3H2,1-2H3 |
| InChIKey | GKXDZWXYJWCPBA-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|