About piperidine;piperidine-1-carbonyl chloride
piperidine;piperidine-1-carbonyl chloride (PubChem CID 158287710) has the molecular formula C11H21ClN2O
and a molecular weight of 232.75 g/mol. Its IUPAC name is piperidine;piperidine-1-carbonyl chloride.
Molecular Properties
| Compound Name | piperidine;piperidine-1-carbonyl chloride |
| PubChem CID | 158287710 |
| Molecular Formula | C11H21ClN2O |
| Molecular Weight | 232.75 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | piperidine;piperidine-1-carbonyl chloride |
| SMILES | C1CCNCC1.O=C(Cl)N1CCCCC1 |
| InChI | InChI=1S/C6H10ClNO.C5H11N/c7-6(9)8-4-2-1-3-5-8;1-2-4-6-5-3-1/h1-5H2;6H,1-5H2 |
| InChIKey | GKZFTXXQQICJLF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.75 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze piperidine;piperidine-1-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidine;piperidine-1-carbonyl chloride?
The IUPAC name of piperidine;piperidine-1-carbonyl chloride (CID 158287710) is piperidine;piperidine-1-carbonyl chloride.
What is the SMILES notation for piperidine;piperidine-1-carbonyl chloride?
The canonical SMILES for piperidine;piperidine-1-carbonyl chloride is C1CCNCC1.O=C(Cl)N1CCCCC1.
What is the InChIKey of piperidine;piperidine-1-carbonyl chloride?
The InChIKey is GKZFTXXQQICJLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10ClNO.C5H11N/c7-6(9)8-4-2-1-3-5-8;1-2-4-6-5-3-1/h1-5H2;6H,1-5H2.
What are the key properties of piperidine;piperidine-1-carbonyl chloride?
piperidine;piperidine-1-carbonyl chloride has a molecular weight of 232.75 g/mol, XLogP of 2.59, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine;piperidine-1-carbonyl chloride is sourced from PubChem (CID 158287710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).