About methane;1-methoxy-3,6,8-tris(methylsulfonyl)pyrene
methane;1-methoxy-3,6,8-tris(methylsulfonyl)pyrene (PubChem CID 158287758) has the molecular formula C21H22O7S3
and a molecular weight of 482.60 g/mol. Its IUPAC name is methane;1-methoxy-3,6,8-tris(methylsulfonyl)pyrene.
Molecular Properties
| Compound Name | methane;1-methoxy-3,6,8-tris(methylsulfonyl)pyrene |
| PubChem CID | 158287758 |
| Molecular Formula | C21H22O7S3 |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | methane;1-methoxy-3,6,8-tris(methylsulfonyl)pyrene |
| SMILES | C.COc1cc(S(C)(=O)=O)c2ccc3c(S(C)(=O)=O)cc(S(C)(=O)=O)c4ccc1c2c43 |
| InChI | InChI=1S/C20H18O7S3.CH4/c1-27-15-9-16(28(2,21)22)12-7-8-14-18(30(4,25)26)10-17(29(3,23)24)13-6-5-11(15)19(12)20(13)14;/h5-10H,1-4H3;1H4 |
| InChIKey | GKZJIMOMSKYVFY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 111.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze methane;1-methoxy-3,6,8-tris(methylsulfonyl)pyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-methoxy-3,6,8-tris(methylsulfonyl)pyrene?
The IUPAC name of methane;1-methoxy-3,6,8-tris(methylsulfonyl)pyrene (CID 158287758) is methane;1-methoxy-3,6,8-tris(methylsulfonyl)pyrene.
What is the SMILES notation for methane;1-methoxy-3,6,8-tris(methylsulfonyl)pyrene?
The canonical SMILES for methane;1-methoxy-3,6,8-tris(methylsulfonyl)pyrene is C.COc1cc(S(C)(=O)=O)c2ccc3c(S(C)(=O)=O)cc(S(C)(=O)=O)c4ccc1c2c43.
What is the InChIKey of methane;1-methoxy-3,6,8-tris(methylsulfonyl)pyrene?
The InChIKey is GKZJIMOMSKYVFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18O7S3.CH4/c1-27-15-9-16(28(2,21)22)12-7-8-14-18(30(4,25)26)10-17(29(3,23)24)13-6-5-11(15)19(12)20(13)14;/h5-10H,1-4H3;1H4.
What are the key properties of methane;1-methoxy-3,6,8-tris(methylsulfonyl)pyrene?
methane;1-methoxy-3,6,8-tris(methylsulfonyl)pyrene has a molecular weight of 482.60 g/mol, XLogP of 3.44, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-methoxy-3,6,8-tris(methylsulfonyl)pyrene is sourced from PubChem (CID 158287758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).