C21H26BN3O2 — CID 158287907
(3S,5R)-4-(11-ethyl-10-hydroxy-7,11,12-triaza-10-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)adamantan-1-ol (PubChem CID 158287907) has the molecular formula C21H26BN3O2 and a molecular weight of 363.27 g/mol. Its IUPAC name is (3S,5R)-4-(11-ethyl-10-hydroxy-7,11,12-triaza-10-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)adamantan-1-ol.
| Compound Name | (3S,5R)-4-(11-ethyl-10-hydroxy-7,11,12-triaza-10-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)adamantan-1-ol |
|---|---|
| PubChem CID | 158287907 |
| Molecular Formula | C21H26BN3O2 |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | (3S,5R)-4-(11-ethyl-10-hydroxy-7,11,12-triaza-10-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)adamantan-1-ol |
| SMILES | CCN1N=C(C2[C@@H]3CC4C[C@H]2CC(O)(C4)C3)c2c(cnc3c2C=CC3)B1O |
| InChI | InChI=1S/C21H26BN3O2/c1-2-25-22(27)16-11-23-17-5-3-4-15(17)19(16)20(24-25)18-13-6-12-7-14(18)10-21(26,8-12)9-13/h3-4,11-14,18,26-27H,2,5-10H2,1H3/t12?,13-,14+,18?,21? |
| InChIKey | YVMDOICMHUPVLP-ZLBVVEMGSA-N |
| XLogP | 1.57 |
| TPSA | 68.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|