C23H28BN3O — CID 158287908
9-[(1S,3R)-5-methyl-2-adamantyl]-3-oxa-7,8,16-triaza-2-boratetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),8,10,12,15-pentaene (PubChem CID 158287908) has the molecular formula C23H28BN3O and a molecular weight of 373.31 g/mol. Its IUPAC name is 9-[(1S,3R)-5-methyl-2-adamantyl]-3-oxa-7,8,16-triaza-2-boratetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),8,10,12,15-pentaene.
| Compound Name | 9-[(1S,3R)-5-methyl-2-adamantyl]-3-oxa-7,8,16-triaza-2-boratetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),8,10,12,15-pentaene |
|---|---|
| PubChem CID | 158287908 |
| Molecular Formula | C23H28BN3O |
| Molecular Weight | 373.31 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | 9-[(1S,3R)-5-methyl-2-adamantyl]-3-oxa-7,8,16-triaza-2-boratetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),8,10,12,15-pentaene |
| SMILES | CC12CC3C[C@H](C1)C(C1=NN4CCCOB4c4cnc5c(c41)C=CC5)[C@@H](C3)C2 |
| InChI | InChI=1S/C23H28BN3O/c1-23-10-14-8-15(11-23)20(16(9-14)12-23)22-21-17-4-2-5-19(17)25-13-18(21)24-27(26-22)6-3-7-28-24/h2,4,13-16,20H,3,5-12H2,1H3/t14?,15-,16+,20?,23? |
| InChIKey | AVOFWBPCPJERDK-NDEWWWAJSA-N |
| XLogP | 3.25 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|