C25H32BN3O — CID 158287909
6,6-dimethyl-9-[(1R,3S)-5-methyl-2-adamantyl]-3-oxa-7,8,16-triaza-2-boratetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),8,10,12,15-pentaene (PubChem CID 158287909) has the molecular formula C25H32BN3O and a molecular weight of 401.36 g/mol. Its IUPAC name is 6,6-dimethyl-9-[(1R,3S)-5-methyl-2-adamantyl]-3-oxa-7,8,16-triaza-2-boratetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),8,10,12,15-pentaene.
| Compound Name | 6,6-dimethyl-9-[(1R,3S)-5-methyl-2-adamantyl]-3-oxa-7,8,16-triaza-2-boratetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),8,10,12,15-pentaene |
|---|---|
| PubChem CID | 158287909 |
| Molecular Formula | C25H32BN3O |
| Molecular Weight | 401.36 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | 6,6-dimethyl-9-[(1R,3S)-5-methyl-2-adamantyl]-3-oxa-7,8,16-triaza-2-boratetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),8,10,12,15-pentaene |
| SMILES | CC12CC3C[C@H](C1)C(C1=NN4B(OCCC4(C)C)c4cnc5c(c41)C=CC5)[C@@H](C3)C2 |
| InChI | InChI=1S/C25H32BN3O/c1-24(2)7-8-30-26-19-14-27-20-6-4-5-18(20)22(19)23(28-29(24)26)21-16-9-15-10-17(21)13-25(3,11-15)12-16/h4-5,14-17,21H,6-13H2,1-3H3/t15?,16-,17+,21?,25? |
| InChIKey | OZVGJNKMMOTCPT-GXWBDACFSA-N |
| XLogP | 4.03 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|