C24H31BrN4S+2 — CID 158290485
3-[(4E)-4-[(6-bromo-4-methyl-[1,3]thiazolo[4,5-b]pyridin-4-ium-2-yl)methylidene]quinolin-1-yl]propyl-trimethylazanium;methane (PubChem CID 158290485) has the molecular formula C24H31BrN4S+2 and a molecular weight of 487.51 g/mol. Its IUPAC name is 3-[(4E)-4-[(6-bromo-4-methyl-[1,3]thiazolo[4,5-b]pyridin-4-ium-2-yl)methylidene]quinolin-1-yl]propyl-trimethylazanium;methane.
| Compound Name | 3-[(4E)-4-[(6-bromo-4-methyl-[1,3]thiazolo[4,5-b]pyridin-4-ium-2-yl)methylidene]quinolin-1-yl]propyl-trimethylazanium;methane |
|---|---|
| PubChem CID | 158290485 |
| Molecular Formula | C24H31BrN4S+2 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 3-[(4E)-4-[(6-bromo-4-methyl-[1,3]thiazolo[4,5-b]pyridin-4-ium-2-yl)methylidene]quinolin-1-yl]propyl-trimethylazanium;methane |
| SMILES | C.C[n+]1cc(Br)cc2sc(/C=C3\C=CN(CCC[N+](C)(C)C)c4ccccc43)nc21 |
| InChI | InChI=1S/C23H27BrN4S.CH4/c1-26-16-18(24)15-21-23(26)25-22(29-21)14-17-10-12-27(11-7-13-28(2,3)4)20-9-6-5-8-19(17)20;/h5-6,8-10,12,14-16H,7,11,13H2,1-4H3;1H4/q+2; |
| InChIKey | GLHDSUXNOLBWJO-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 20.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|