C24H31F3O6S3 — CID 158292135
dibenzyl(cyclohexyl)sulfanium;1,1,2-trifluoro-3-methylsulfonyloxypropane-1-sulfonate (PubChem CID 158292135) has the molecular formula C24H31F3O6S3 and a molecular weight of 568.70 g/mol. Its IUPAC name is dibenzyl(cyclohexyl)sulfanium;1,1,2-trifluoro-3-methylsulfonyloxypropane-1-sulfonate.
| Compound Name | dibenzyl(cyclohexyl)sulfanium;1,1,2-trifluoro-3-methylsulfonyloxypropane-1-sulfonate |
|---|---|
| PubChem CID | 158292135 |
| Molecular Formula | C24H31F3O6S3 |
| Molecular Weight | 568.70 g/mol |
| Exact Mass | 568.12 |
| IUPAC Name | dibenzyl(cyclohexyl)sulfanium;1,1,2-trifluoro-3-methylsulfonyloxypropane-1-sulfonate |
| SMILES | CS(=O)(=O)OCC(F)C(F)(F)S(=O)(=O)[O-].c1ccc(C[S+](Cc2ccccc2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C20H25S.C4H7F3O6S2/c1-4-10-18(11-5-1)16-21(20-14-8-3-9-15-20)17-19-12-6-2-7-13-19;1-14(8,9)13-2-3(5)4(6,7)15(10,11)12/h1-2,4-7,10-13,20H,3,8-9,14-17H2;3H,2H2,1H3,(H,10,11,12)/q+1;/p-1 |
| InChIKey | GLMDPPYUIBBTNO-UHFFFAOYSA-M |
| XLogP | 4.78 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.70 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|