C10H11NO2 — CID 158292836
8-methyl-1-azaspiro[4.5]deca-7,9-diene-2,6-dione (PubChem CID 158292836) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 8-methyl-1-azaspiro[4.5]deca-7,9-diene-2,6-dione.
| Compound Name | 8-methyl-1-azaspiro[4.5]deca-7,9-diene-2,6-dione |
|---|---|
| PubChem CID | 158292836 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 8-methyl-1-azaspiro[4.5]deca-7,9-diene-2,6-dione |
| SMILES | CC1=CC(=O)C2(C=C1)CCC(=O)N2 |
| InChI | InChI=1S/C10H11NO2/c1-7-2-4-10(8(12)6-7)5-3-9(13)11-10/h2,4,6H,3,5H2,1H3,(H,11,13) |
| InChIKey | GLOIFMSCGXGQMJ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |