C27H34BrClFN5O7 — CID 158295017
1-O-tert-butyl 4-O-methyl 4-[[7-bromo-6-chloro-8-fluoro-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-3-nitroquinolin-4-yl]amino]piperidine-1,4-dicarboxylate (PubChem CID 158295017) has the molecular formula C27H34BrClFN5O7 and a molecular weight of 674.95 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-methyl 4-[[7-bromo-6-chloro-8-fluoro-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-3-nitroquinolin-4-yl]amino]piperidine-1,4-dicarboxylate.
| Compound Name | 1-O-tert-butyl 4-O-methyl 4-[[7-bromo-6-chloro-8-fluoro-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-3-nitroquinolin-4-yl]amino]piperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 158295017 |
| Molecular Formula | C27H34BrClFN5O7 |
| Molecular Weight | 674.95 g/mol |
| Exact Mass | 673.13 |
| IUPAC Name | 1-O-tert-butyl 4-O-methyl 4-[[7-bromo-6-chloro-8-fluoro-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-3-nitroquinolin-4-yl]amino]piperidine-1,4-dicarboxylate |
| SMILES | COC(=O)C1(Nc2c([N+](=O)[O-])c(OC[C@@H]3CCCN3C)nc3c(F)c(Br)c(Cl)cc23)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C27H34BrClFN5O7/c1-26(2,3)42-25(37)34-11-8-27(9-12-34,24(36)40-5)32-21-16-13-17(29)18(28)19(30)20(16)31-23(22(21)35(38)39)41-14-15-7-6-10-33(15)4/h13,15H,6-12,14H2,1-5H3,(H,31,32)/t15-/m0/s1 |
| InChIKey | GLUPWLDLEGMDDC-HNNXBMFYSA-N |
| XLogP | 5.53 |
| TPSA | 136.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.95 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|