C14H12B2O4 — CID 15829533
5-methyl-2-(5-methyl-1,3,2-benzodioxaborol-2-yl)-1,3,2-benzodioxaborole (PubChem CID 15829533) has the molecular formula C14H12B2O4 and a molecular weight of 265.87 g/mol. Its IUPAC name is 5-methyl-2-(5-methyl-1,3,2-benzodioxaborol-2-yl)-1,3,2-benzodioxaborole.
| Compound Name | 5-methyl-2-(5-methyl-1,3,2-benzodioxaborol-2-yl)-1,3,2-benzodioxaborole |
|---|---|
| PubChem CID | 15829533 |
| Molecular Formula | C14H12B2O4 |
| Molecular Weight | 265.87 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 5-methyl-2-(5-methyl-1,3,2-benzodioxaborol-2-yl)-1,3,2-benzodioxaborole |
| SMILES | Cc1ccc2c(c1)OB(B1Oc3ccc(C)cc3O1)O2 |
| InChI | InChI=1S/C14H12B2O4/c1-9-3-5-11-13(7-9)19-15(17-11)16-18-12-6-4-10(2)8-14(12)20-16/h3-8H,1-2H3 |
| InChIKey | BYFRSHMXUKRPCN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.87 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|