C46H50F9O3S2+ — CID 158295863
(2,4,6-tricyclohexylphenyl) 1,1,2,2,3,3-hexafluorobutane-1-sulfonate;tris(4-fluorophenyl)sulfanium (PubChem CID 158295863) has the molecular formula C46H50F9O3S2+ and a molecular weight of 886.02 g/mol. Its IUPAC name is (2,4,6-tricyclohexylphenyl) 1,1,2,2,3,3-hexafluorobutane-1-sulfonate;tris(4-fluorophenyl)sulfanium.
| Compound Name | (2,4,6-tricyclohexylphenyl) 1,1,2,2,3,3-hexafluorobutane-1-sulfonate;tris(4-fluorophenyl)sulfanium |
|---|---|
| PubChem CID | 158295863 |
| Molecular Formula | C46H50F9O3S2+ |
| Molecular Weight | 886.02 g/mol |
| Exact Mass | 885.31 |
| IUPAC Name | (2,4,6-tricyclohexylphenyl) 1,1,2,2,3,3-hexafluorobutane-1-sulfonate;tris(4-fluorophenyl)sulfanium |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)S(=O)(=O)Oc1c(C2CCCCC2)cc(C2CCCCC2)cc1C1CCCCC1.Fc1ccc([S+](c2ccc(F)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H38F6O3S.C18H12F3S/c1-26(29,30)27(31,32)28(33,34)38(35,36)37-25-23(20-13-7-3-8-14-20)17-22(19-11-5-2-6-12-19)18-24(25)21-15-9-4-10-16-21;19-13-1-7-16(8-2-13)22(17-9-3-14(20)4-10-17)18-11-5-15(21)6-12-18/h17-21H,2-16H2,1H3;1-12H/q;+1 |
| InChIKey | GLXASVRVLBEJPB-UHFFFAOYSA-N |
| XLogP | 14.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.02 |
| LogP ≤ 5 | 14.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|