About CID 158296253
CID 158296253 (PubChem CID 158296253) has the molecular formula C20H27BO2Si
and a molecular weight of 338.33 g/mol.
Molecular Properties
| Compound Name | CID 158296253 |
| PubChem CID | 158296253 |
| Molecular Formula | C20H27BO2Si |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O.[B]c1cccc2c1[Si](C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C14H13BSi.C6H14O2/c1-16(2)13-9-4-3-6-10(13)11-7-5-8-12(15)14(11)16;1-5(2,7)6(3,4)8/h3-9H,1-2H3;7-8H,1-4H3 |
| InChIKey | IBPAGIJAZJXUAD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 158296253 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158296253?
The IUPAC name of CID 158296253 (CID 158296253) is not available.
What is the SMILES notation for CID 158296253?
The canonical SMILES for CID 158296253 is CC(C)(O)C(C)(C)O.[B]c1cccc2c1[Si](C)(C)c1ccccc1-2.
What is the InChIKey of CID 158296253?
The InChIKey is IBPAGIJAZJXUAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BSi.C6H14O2/c1-16(2)13-9-4-3-6-10(13)11-7-5-8-12(15)14(11)16;1-5(2,7)6(3,4)8/h3-9H,1-2H3;7-8H,1-4H3.
What are the key properties of CID 158296253?
CID 158296253 has a molecular weight of 338.33 g/mol, XLogP of 1.81, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158296253 is sourced from PubChem (CID 158296253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).