About 9-methyl-10H-anthracen-9-ol;9-methylfluoren-9-ol;9-methylxanthen-9-ol
9-methyl-10H-anthracen-9-ol;9-methylfluoren-9-ol;9-methylxanthen-9-ol (PubChem CID 158296275) has the molecular formula C43H38O4
and a molecular weight of 618.77 g/mol. Its IUPAC name is 9-methyl-10H-anthracen-9-ol;9-methylfluoren-9-ol;9-methylxanthen-9-ol.
Molecular Properties
| Compound Name | 9-methyl-10H-anthracen-9-ol;9-methylfluoren-9-ol;9-methylxanthen-9-ol |
| PubChem CID | 158296275 |
| Molecular Formula | C43H38O4 |
| Molecular Weight | 618.77 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | 9-methyl-10H-anthracen-9-ol;9-methylfluoren-9-ol;9-methylxanthen-9-ol |
| SMILES | CC1(O)c2ccccc2-c2ccccc21.CC1(O)c2ccccc2Cc2ccccc21.CC1(O)c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C15H14O.C14H12O2.C14H12O/c1-15(16)13-8-4-2-6-11(13)10-12-7-3-5-9-14(12)15;1-14(15)10-6-2-4-8-12(10)16-13-9-5-3-7-11(13)14;1-14(15)12-8-4-2-6-10(12)11-7-3-5-9-13(11)14/h2-9,16H,10H2,1H3;2-9,15H,1H3;2-9,15H,1H3 |
| InChIKey | GLYDPVWRPTZEPG-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 618.77 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-methyl-10H-anthracen-9-ol;9-methylfluoren-9-ol;9-methylxanthen-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-10H-anthracen-9-ol;9-methylfluoren-9-ol;9-methylxanthen-9-ol?
The IUPAC name of 9-methyl-10H-anthracen-9-ol;9-methylfluoren-9-ol;9-methylxanthen-9-ol (CID 158296275) is 9-methyl-10H-anthracen-9-ol;9-methylfluoren-9-ol;9-methylxanthen-9-ol.
What is the SMILES notation for 9-methyl-10H-anthracen-9-ol;9-methylfluoren-9-ol;9-methylxanthen-9-ol?
The canonical SMILES for 9-methyl-10H-anthracen-9-ol;9-methylfluoren-9-ol;9-methylxanthen-9-ol is CC1(O)c2ccccc2-c2ccccc21.CC1(O)c2ccccc2Cc2ccccc21.CC1(O)c2ccccc2Oc2ccccc21.
What is the InChIKey of 9-methyl-10H-anthracen-9-ol;9-methylfluoren-9-ol;9-methylxanthen-9-ol?
The InChIKey is GLYDPVWRPTZEPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O.C14H12O2.C14H12O/c1-15(16)13-8-4-2-6-11(13)10-12-7-3-5-9-14(12)15;1-14(15)10-6-2-4-8-12(10)16-13-9-5-3-7-11(13)14;1-14(15)12-8-4-2-6-10(12)11-7-3-5-9-13(11)14/h2-9,16H,10H2,1H3;2-9,15H,1H3;2-9,15H,1H3.
What are the key properties of 9-methyl-10H-anthracen-9-ol;9-methylfluoren-9-ol;9-methylxanthen-9-ol?
9-methyl-10H-anthracen-9-ol;9-methylfluoren-9-ol;9-methylxanthen-9-ol has a molecular weight of 618.77 g/mol, XLogP of 8.82, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-10H-anthracen-9-ol;9-methylfluoren-9-ol;9-methylxanthen-9-ol is sourced from PubChem (CID 158296275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).