About CID 158296360
CID 158296360 (PubChem CID 158296360) has the molecular formula C5H10Na2O7S
and a molecular weight of 260.17 g/mol.
Molecular Properties
| Compound Name | CID 158296360 |
| PubChem CID | 158296360 |
| Molecular Formula | C5H10Na2O7S |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 259.99 |
| IUPAC Name | — |
| SMILES | O=C(O)CC(O)CCOS(=O)(=O)O.[Na].[Na] |
| InChI | InChI=1S/C5H10O7S.2Na/c6-4(3-5(7)8)1-2-12-13(9,10)11;;/h4,6H,1-3H2,(H,7,8)(H,9,10,11);; |
| InChIKey | GIGWRYKDVZRXRH-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 158296360 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158296360?
The IUPAC name of CID 158296360 (CID 158296360) is not available.
What is the SMILES notation for CID 158296360?
The canonical SMILES for CID 158296360 is O=C(O)CC(O)CCOS(=O)(=O)O.[Na].[Na].
What is the InChIKey of CID 158296360?
The InChIKey is GIGWRYKDVZRXRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O7S.2Na/c6-4(3-5(7)8)1-2-12-13(9,10)11;;/h4,6H,1-3H2,(H,7,8)(H,9,10,11);;.
What are the key properties of CID 158296360?
CID 158296360 has a molecular weight of 260.17 g/mol, XLogP of -1.73, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158296360 is sourced from PubChem (CID 158296360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).