About 6-bromo-N-[(4-fluorooxan-4-yl)methyl]pyridin-2-amine;6-bromopyridin-2-amine
6-bromo-N-[(4-fluorooxan-4-yl)methyl]pyridin-2-amine;6-bromopyridin-2-amine (PubChem CID 158296495) has the molecular formula C16H19Br2FN4O
and a molecular weight of 462.16 g/mol. Its IUPAC name is 6-bromo-N-[(4-fluorooxan-4-yl)methyl]pyridin-2-amine;6-bromopyridin-2-amine.
Molecular Properties
| Compound Name | 6-bromo-N-[(4-fluorooxan-4-yl)methyl]pyridin-2-amine;6-bromopyridin-2-amine |
| PubChem CID | 158296495 |
| Molecular Formula | C16H19Br2FN4O |
| Molecular Weight | 462.16 g/mol |
| Exact Mass | 459.99 |
| IUPAC Name | 6-bromo-N-[(4-fluorooxan-4-yl)methyl]pyridin-2-amine;6-bromopyridin-2-amine |
| SMILES | FC1(CNc2cccc(Br)n2)CCOCC1.Nc1cccc(Br)n1 |
| InChI | InChI=1S/C11H14BrFN2O.C5H5BrN2/c12-9-2-1-3-10(15-9)14-8-11(13)4-6-16-7-5-11;6-4-2-1-3-5(7)8-4/h1-3H,4-8H2,(H,14,15);1-3H,(H2,7,8) |
| InChIKey | GLYYKRKFJYTRPI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.16 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-N-[(4-fluorooxan-4-yl)methyl]pyridin-2-amine;6-bromopyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-N-[(4-fluorooxan-4-yl)methyl]pyridin-2-amine;6-bromopyridin-2-amine?
The IUPAC name of 6-bromo-N-[(4-fluorooxan-4-yl)methyl]pyridin-2-amine;6-bromopyridin-2-amine (CID 158296495) is 6-bromo-N-[(4-fluorooxan-4-yl)methyl]pyridin-2-amine;6-bromopyridin-2-amine.
What is the SMILES notation for 6-bromo-N-[(4-fluorooxan-4-yl)methyl]pyridin-2-amine;6-bromopyridin-2-amine?
The canonical SMILES for 6-bromo-N-[(4-fluorooxan-4-yl)methyl]pyridin-2-amine;6-bromopyridin-2-amine is FC1(CNc2cccc(Br)n2)CCOCC1.Nc1cccc(Br)n1.
What is the InChIKey of 6-bromo-N-[(4-fluorooxan-4-yl)methyl]pyridin-2-amine;6-bromopyridin-2-amine?
The InChIKey is GLYYKRKFJYTRPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14BrFN2O.C5H5BrN2/c12-9-2-1-3-10(15-9)14-8-11(13)4-6-16-7-5-11;6-4-2-1-3-5(7)8-4/h1-3H,4-8H2,(H,14,15);1-3H,(H2,7,8).
What are the key properties of 6-bromo-N-[(4-fluorooxan-4-yl)methyl]pyridin-2-amine;6-bromopyridin-2-amine?
6-bromo-N-[(4-fluorooxan-4-yl)methyl]pyridin-2-amine;6-bromopyridin-2-amine has a molecular weight of 462.16 g/mol, XLogP of 4.20, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-N-[(4-fluorooxan-4-yl)methyl]pyridin-2-amine;6-bromopyridin-2-amine is sourced from PubChem (CID 158296495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).