About 7-chloro-1-(oxan-4-ylmethyl)indole-3-carbonitrile;phosphoryl trichloride
7-chloro-1-(oxan-4-ylmethyl)indole-3-carbonitrile;phosphoryl trichloride (PubChem CID 158296761) has the molecular formula C15H15Cl4N2O2P
and a molecular weight of 428.08 g/mol. Its IUPAC name is 7-chloro-1-(oxan-4-ylmethyl)indole-3-carbonitrile;phosphoryl trichloride.
Molecular Properties
| Compound Name | 7-chloro-1-(oxan-4-ylmethyl)indole-3-carbonitrile;phosphoryl trichloride |
| PubChem CID | 158296761 |
| Molecular Formula | C15H15Cl4N2O2P |
| Molecular Weight | 428.08 g/mol |
| Exact Mass | 425.96 |
| IUPAC Name | 7-chloro-1-(oxan-4-ylmethyl)indole-3-carbonitrile;phosphoryl trichloride |
| SMILES | N#Cc1cn(CC2CCOCC2)c2c(Cl)cccc12.O=P(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H15ClN2O.Cl3OP/c16-14-3-1-2-13-12(8-17)10-18(15(13)14)9-11-4-6-19-7-5-11;1-5(2,3)4/h1-3,10-11H,4-7,9H2; |
| InChIKey | GLZVPOODVHWERW-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.08 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-1-(oxan-4-ylmethyl)indole-3-carbonitrile;phosphoryl trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-1-(oxan-4-ylmethyl)indole-3-carbonitrile;phosphoryl trichloride?
The IUPAC name of 7-chloro-1-(oxan-4-ylmethyl)indole-3-carbonitrile;phosphoryl trichloride (CID 158296761) is 7-chloro-1-(oxan-4-ylmethyl)indole-3-carbonitrile;phosphoryl trichloride.
What is the SMILES notation for 7-chloro-1-(oxan-4-ylmethyl)indole-3-carbonitrile;phosphoryl trichloride?
The canonical SMILES for 7-chloro-1-(oxan-4-ylmethyl)indole-3-carbonitrile;phosphoryl trichloride is N#Cc1cn(CC2CCOCC2)c2c(Cl)cccc12.O=P(Cl)(Cl)Cl.
What is the InChIKey of 7-chloro-1-(oxan-4-ylmethyl)indole-3-carbonitrile;phosphoryl trichloride?
The InChIKey is GLZVPOODVHWERW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClN2O.Cl3OP/c16-14-3-1-2-13-12(8-17)10-18(15(13)14)9-11-4-6-19-7-5-11;1-5(2,3)4/h1-3,10-11H,4-7,9H2;.
What are the key properties of 7-chloro-1-(oxan-4-ylmethyl)indole-3-carbonitrile;phosphoryl trichloride?
7-chloro-1-(oxan-4-ylmethyl)indole-3-carbonitrile;phosphoryl trichloride has a molecular weight of 428.08 g/mol, XLogP of 6.40, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-1-(oxan-4-ylmethyl)indole-3-carbonitrile;phosphoryl trichloride is sourced from PubChem (CID 158296761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).