C34H40O4Si — CID 15829737
(2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-1,4-bis(phenylmethoxy)butan-2-ol (PubChem CID 15829737) has the molecular formula C34H40O4Si and a molecular weight of 540.78 g/mol. Its IUPAC name is (2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-1,4-bis(phenylmethoxy)butan-2-ol.
| Compound Name | (2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-1,4-bis(phenylmethoxy)butan-2-ol |
|---|---|
| PubChem CID | 15829737 |
| Molecular Formula | C34H40O4Si |
| Molecular Weight | 540.78 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | (2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-1,4-bis(phenylmethoxy)butan-2-ol |
| SMILES | CC(C)(C)[Si](O[C@@H](COCc1ccccc1)[C@H](O)COCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H40O4Si/c1-34(2,3)39(30-20-12-6-13-21-30,31-22-14-7-15-23-31)38-33(27-37-25-29-18-10-5-11-19-29)32(35)26-36-24-28-16-8-4-9-17-28/h4-23,32-33,35H,24-27H2,1-3H3/t32-,33+/m1/s1 |
| InChIKey | XFLNFEIDDWVGSW-SAIUNTKASA-N |
| XLogP | 5.73 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.78 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|