C24H40O10 — CID 158298092
(6S)-6-ethenyl-7-methoxy-2,2,6-trimethyl-7,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-one;(2S)-1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-methoxy-2-methylbut-3-en-2-ol (PubChem CID 158298092) has the molecular formula C24H40O10 and a molecular weight of 488.57 g/mol. Its IUPAC name is (6S)-6-ethenyl-7-methoxy-2,2,6-trimethyl-7,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-one;(2S)-1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-methoxy-2-methylbut-3-en-2-ol.
| Compound Name | (6S)-6-ethenyl-7-methoxy-2,2,6-trimethyl-7,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-one;(2S)-1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-methoxy-2-methylbut-3-en-2-ol |
|---|---|
| PubChem CID | 158298092 |
| Molecular Formula | C24H40O10 |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | (6S)-6-ethenyl-7-methoxy-2,2,6-trimethyl-7,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-one;(2S)-1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-methoxy-2-methylbut-3-en-2-ol |
| SMILES | C=C[C@](C)(O)C(OC)C1OC(C)(C)OC1CO.C=C[C@]1(C)OC(=O)C2OC(C)(C)OC2C1OC |
| InChI | InChI=1S/C12H18O5.C12H22O5/c1-6-12(4)9(14-5)7-8(10(13)17-12)16-11(2,3)15-7;1-6-12(4,14)10(15-5)9-8(7-13)16-11(2,3)17-9/h6-9H,1H2,2-5H3;6,8-10,13-14H,1,7H2,2-5H3/t7?,8?,9?,12-;8?,9?,10?,12-/m00/s1 |
| InChIKey | GMDSDYVAVQEUCY-KFXYIUJHSA-N |
| XLogP | 1.47 |
| TPSA | 122.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|