About [(2S)-1-cyanobutan-2-yl] acetate;3-hydroxypentanenitrile;(3R)-3-hydroxypentanenitrile
[(2S)-1-cyanobutan-2-yl] acetate;3-hydroxypentanenitrile;(3R)-3-hydroxypentanenitrile (PubChem CID 158298430) has the molecular formula C17H29N3O4
and a molecular weight of 339.44 g/mol. Its IUPAC name is [(2S)-1-cyanobutan-2-yl] acetate;3-hydroxypentanenitrile;(3R)-3-hydroxypentanenitrile.
Molecular Properties
| Compound Name | [(2S)-1-cyanobutan-2-yl] acetate;3-hydroxypentanenitrile;(3R)-3-hydroxypentanenitrile |
| PubChem CID | 158298430 |
| Molecular Formula | C17H29N3O4 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | [(2S)-1-cyanobutan-2-yl] acetate;3-hydroxypentanenitrile;(3R)-3-hydroxypentanenitrile |
| SMILES | CCC(O)CC#N.CC[C@@H](CC#N)OC(C)=O.CC[C@@H](O)CC#N |
| InChI | InChI=1S/C7H11NO2.2C5H9NO/c1-3-7(4-5-8)10-6(2)9;2*1-2-5(7)3-4-6/h7H,3-4H2,1-2H3;2*5,7H,2-3H2,1H3/t7-;5-;/m01./s1 |
| InChIKey | GMEWFGMTXGYIPQ-WHXIDUSXSA-N |
| XLogP | 2.58 |
| TPSA | 138.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [(2S)-1-cyanobutan-2-yl] acetate;3-hydroxypentanenitrile;(3R)-3-hydroxypentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-cyanobutan-2-yl] acetate;3-hydroxypentanenitrile;(3R)-3-hydroxypentanenitrile?
The IUPAC name of [(2S)-1-cyanobutan-2-yl] acetate;3-hydroxypentanenitrile;(3R)-3-hydroxypentanenitrile (CID 158298430) is [(2S)-1-cyanobutan-2-yl] acetate;3-hydroxypentanenitrile;(3R)-3-hydroxypentanenitrile.
What is the SMILES notation for [(2S)-1-cyanobutan-2-yl] acetate;3-hydroxypentanenitrile;(3R)-3-hydroxypentanenitrile?
The canonical SMILES for [(2S)-1-cyanobutan-2-yl] acetate;3-hydroxypentanenitrile;(3R)-3-hydroxypentanenitrile is CCC(O)CC#N.CC[C@@H](CC#N)OC(C)=O.CC[C@@H](O)CC#N.
What is the InChIKey of [(2S)-1-cyanobutan-2-yl] acetate;3-hydroxypentanenitrile;(3R)-3-hydroxypentanenitrile?
The InChIKey is GMEWFGMTXGYIPQ-WHXIDUSXSA-N. The full InChI is InChI=1S/C7H11NO2.2C5H9NO/c1-3-7(4-5-8)10-6(2)9;2*1-2-5(7)3-4-6/h7H,3-4H2,1-2H3;2*5,7H,2-3H2,1H3/t7-;5-;/m01./s1.
What are the key properties of [(2S)-1-cyanobutan-2-yl] acetate;3-hydroxypentanenitrile;(3R)-3-hydroxypentanenitrile?
[(2S)-1-cyanobutan-2-yl] acetate;3-hydroxypentanenitrile;(3R)-3-hydroxypentanenitrile has a molecular weight of 339.44 g/mol, XLogP of 2.58, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-cyanobutan-2-yl] acetate;3-hydroxypentanenitrile;(3R)-3-hydroxypentanenitrile is sourced from PubChem (CID 158298430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).