About methane;4-methyl-1-trimethylsilylpentane-1,3-dione
methane;4-methyl-1-trimethylsilylpentane-1,3-dione (PubChem CID 158299529) has the molecular formula C10H22O2Si
and a molecular weight of 202.37 g/mol. Its IUPAC name is methane;4-methyl-1-trimethylsilylpentane-1,3-dione.
Molecular Properties
| Compound Name | methane;4-methyl-1-trimethylsilylpentane-1,3-dione |
| PubChem CID | 158299529 |
| Molecular Formula | C10H22O2Si |
| Molecular Weight | 202.37 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | methane;4-methyl-1-trimethylsilylpentane-1,3-dione |
| SMILES | C.CC(C)C(=O)CC(=O)[Si](C)(C)C |
| InChI | InChI=1S/C9H18O2Si.CH4/c1-7(2)8(10)6-9(11)12(3,4)5;/h7H,6H2,1-5H3;1H4 |
| InChIKey | GMIGKLWWBFLRRC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methane;4-methyl-1-trimethylsilylpentane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;4-methyl-1-trimethylsilylpentane-1,3-dione?
The IUPAC name of methane;4-methyl-1-trimethylsilylpentane-1,3-dione (CID 158299529) is methane;4-methyl-1-trimethylsilylpentane-1,3-dione.
What is the SMILES notation for methane;4-methyl-1-trimethylsilylpentane-1,3-dione?
The canonical SMILES for methane;4-methyl-1-trimethylsilylpentane-1,3-dione is C.CC(C)C(=O)CC(=O)[Si](C)(C)C.
What is the InChIKey of methane;4-methyl-1-trimethylsilylpentane-1,3-dione?
The InChIKey is GMIGKLWWBFLRRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2Si.CH4/c1-7(2)8(10)6-9(11)12(3,4)5;/h7H,6H2,1-5H3;1H4.
What are the key properties of methane;4-methyl-1-trimethylsilylpentane-1,3-dione?
methane;4-methyl-1-trimethylsilylpentane-1,3-dione has a molecular weight of 202.37 g/mol, XLogP of 2.68, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;4-methyl-1-trimethylsilylpentane-1,3-dione is sourced from PubChem (CID 158299529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).