About 2-(4-chloro-2,6-difluorophenyl)-5-fluoro-1-methyl-6-methylidene-3-phenylpyridine
2-(4-chloro-2,6-difluorophenyl)-5-fluoro-1-methyl-6-methylidene-3-phenylpyridine (PubChem CID 158300340) has the molecular formula C19H13ClF3N
and a molecular weight of 347.77 g/mol. Its IUPAC name is 2-(4-chloro-2,6-difluorophenyl)-5-fluoro-1-methyl-6-methylidene-3-phenylpyridine.
Molecular Properties
| Compound Name | 2-(4-chloro-2,6-difluorophenyl)-5-fluoro-1-methyl-6-methylidene-3-phenylpyridine |
| PubChem CID | 158300340 |
| Molecular Formula | C19H13ClF3N |
| Molecular Weight | 347.77 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 2-(4-chloro-2,6-difluorophenyl)-5-fluoro-1-methyl-6-methylidene-3-phenylpyridine |
| SMILES | C=C1C(F)=CC(c2ccccc2)=C(c2c(F)cc(Cl)cc2F)N1C |
| InChI | InChI=1S/C19H13ClF3N/c1-11-15(21)10-14(12-6-4-3-5-7-12)19(24(11)2)18-16(22)8-13(20)9-17(18)23/h3-10H,1H2,2H3 |
| InChIKey | ROBCZBFUMLCUCE-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.77 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chloro-2,6-difluorophenyl)-5-fluoro-1-methyl-6-methylidene-3-phenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloro-2,6-difluorophenyl)-5-fluoro-1-methyl-6-methylidene-3-phenylpyridine?
The IUPAC name of 2-(4-chloro-2,6-difluorophenyl)-5-fluoro-1-methyl-6-methylidene-3-phenylpyridine (CID 158300340) is 2-(4-chloro-2,6-difluorophenyl)-5-fluoro-1-methyl-6-methylidene-3-phenylpyridine.
What is the SMILES notation for 2-(4-chloro-2,6-difluorophenyl)-5-fluoro-1-methyl-6-methylidene-3-phenylpyridine?
The canonical SMILES for 2-(4-chloro-2,6-difluorophenyl)-5-fluoro-1-methyl-6-methylidene-3-phenylpyridine is C=C1C(F)=CC(c2ccccc2)=C(c2c(F)cc(Cl)cc2F)N1C.
What is the InChIKey of 2-(4-chloro-2,6-difluorophenyl)-5-fluoro-1-methyl-6-methylidene-3-phenylpyridine?
The InChIKey is ROBCZBFUMLCUCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13ClF3N/c1-11-15(21)10-14(12-6-4-3-5-7-12)19(24(11)2)18-16(22)8-13(20)9-17(18)23/h3-10H,1H2,2H3.
What are the key properties of 2-(4-chloro-2,6-difluorophenyl)-5-fluoro-1-methyl-6-methylidene-3-phenylpyridine?
2-(4-chloro-2,6-difluorophenyl)-5-fluoro-1-methyl-6-methylidene-3-phenylpyridine has a molecular weight of 347.77 g/mol, XLogP of 5.80, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-2,6-difluorophenyl)-5-fluoro-1-methyl-6-methylidene-3-phenylpyridine is sourced from PubChem (CID 158300340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).