About 3-(dimethylamino)butan-2-one;N,N',N'-trimethylacetohydrazide
3-(dimethylamino)butan-2-one;N,N',N'-trimethylacetohydrazide (PubChem CID 158300790) has the molecular formula C11H25N3O2
and a molecular weight of 231.34 g/mol. Its IUPAC name is 3-(dimethylamino)butan-2-one;N,N',N'-trimethylacetohydrazide.
Molecular Properties
| Compound Name | 3-(dimethylamino)butan-2-one;N,N',N'-trimethylacetohydrazide |
| PubChem CID | 158300790 |
| Molecular Formula | C11H25N3O2 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.19 |
| IUPAC Name | 3-(dimethylamino)butan-2-one;N,N',N'-trimethylacetohydrazide |
| SMILES | CC(=O)C(C)N(C)C.CC(=O)N(C)N(C)C |
| InChI | InChI=1S/C6H13NO.C5H12N2O/c1-5(6(2)8)7(3)4;1-5(8)7(4)6(2)3/h5H,1-4H3;1-4H3 |
| InChIKey | GMLYPQUTJIYVBH-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylamino)butan-2-one;N,N',N'-trimethylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)butan-2-one;N,N',N'-trimethylacetohydrazide?
The IUPAC name of 3-(dimethylamino)butan-2-one;N,N',N'-trimethylacetohydrazide (CID 158300790) is 3-(dimethylamino)butan-2-one;N,N',N'-trimethylacetohydrazide.
What is the SMILES notation for 3-(dimethylamino)butan-2-one;N,N',N'-trimethylacetohydrazide?
The canonical SMILES for 3-(dimethylamino)butan-2-one;N,N',N'-trimethylacetohydrazide is CC(=O)C(C)N(C)C.CC(=O)N(C)N(C)C.
What is the InChIKey of 3-(dimethylamino)butan-2-one;N,N',N'-trimethylacetohydrazide?
The InChIKey is GMLYPQUTJIYVBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO.C5H12N2O/c1-5(6(2)8)7(3)4;1-5(8)7(4)6(2)3/h5H,1-4H3;1-4H3.
What are the key properties of 3-(dimethylamino)butan-2-one;N,N',N'-trimethylacetohydrazide?
3-(dimethylamino)butan-2-one;N,N',N'-trimethylacetohydrazide has a molecular weight of 231.34 g/mol, XLogP of 0.47, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)butan-2-one;N,N',N'-trimethylacetohydrazide is sourced from PubChem (CID 158300790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).