C15H27KN2O2 — CID 158300860
potassium;N,N-dimethyl-5-methylidene-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide;2-methylpropan-2-olate (PubChem CID 158300860) has the molecular formula C15H27KN2O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is potassium;N,N-dimethyl-5-methylidene-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide;2-methylpropan-2-olate.
| Compound Name | potassium;N,N-dimethyl-5-methylidene-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide;2-methylpropan-2-olate |
|---|---|
| PubChem CID | 158300860 |
| Molecular Formula | C15H27KN2O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | potassium;N,N-dimethyl-5-methylidene-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide;2-methylpropan-2-olate |
| SMILES | C=C1CC2CN(C(=O)N(C)C)CC2C1.CC(C)(C)[O-].[K+] |
| InChI | InChI=1S/C11H18N2O.C4H9O.K/c1-8-4-9-6-13(7-10(9)5-8)11(14)12(2)3;1-4(2,3)5;/h9-10H,1,4-7H2,2-3H3;1-3H3;/q;-1;+1 |
| InChIKey | GMMCPGQOGVFGGX-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|