About [2-cyano-3-(trifluoromethyl)-4-pyridinyl] cyanate;sulfane
[2-cyano-3-(trifluoromethyl)-4-pyridinyl] cyanate;sulfane (PubChem CID 158300990) has the molecular formula C8H4F3N3OS
and a molecular weight of 247.20 g/mol. Its IUPAC name is [2-cyano-3-(trifluoromethyl)-4-pyridinyl] cyanate;sulfane.
Molecular Properties
| Compound Name | [2-cyano-3-(trifluoromethyl)-4-pyridinyl] cyanate;sulfane |
| PubChem CID | 158300990 |
| Molecular Formula | C8H4F3N3OS |
| Molecular Weight | 247.20 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | [2-cyano-3-(trifluoromethyl)-4-pyridinyl] cyanate;sulfane |
| SMILES | N#COc1ccnc(C#N)c1C(F)(F)F.S |
| InChI | InChI=1S/C8H2F3N3O.H2S/c9-8(10,11)7-5(3-12)14-2-1-6(7)15-4-13;/h1-2H;1H2 |
| InChIKey | DHCCJGQLKVUTBR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.20 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [2-cyano-3-(trifluoromethyl)-4-pyridinyl] cyanate;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-cyano-3-(trifluoromethyl)-4-pyridinyl] cyanate;sulfane?
The IUPAC name of [2-cyano-3-(trifluoromethyl)-4-pyridinyl] cyanate;sulfane (CID 158300990) is [2-cyano-3-(trifluoromethyl)-4-pyridinyl] cyanate;sulfane.
What is the SMILES notation for [2-cyano-3-(trifluoromethyl)-4-pyridinyl] cyanate;sulfane?
The canonical SMILES for [2-cyano-3-(trifluoromethyl)-4-pyridinyl] cyanate;sulfane is N#COc1ccnc(C#N)c1C(F)(F)F.S.
What is the InChIKey of [2-cyano-3-(trifluoromethyl)-4-pyridinyl] cyanate;sulfane?
The InChIKey is DHCCJGQLKVUTBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H2F3N3O.H2S/c9-8(10,11)7-5(3-12)14-2-1-6(7)15-4-13;/h1-2H;1H2.
What are the key properties of [2-cyano-3-(trifluoromethyl)-4-pyridinyl] cyanate;sulfane?
[2-cyano-3-(trifluoromethyl)-4-pyridinyl] cyanate;sulfane has a molecular weight of 247.20 g/mol, XLogP of 1.94, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-cyano-3-(trifluoromethyl)-4-pyridinyl] cyanate;sulfane is sourced from PubChem (CID 158300990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).