C27H46O3Si — CID 158303057
(1S,4R,5S,6R,7R,8R,9R,10R,12R,14R)-8-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3,6,7,11,11,14-hexamethyltetracyclo[7.5.1.01,5.010,12]pentadec-2-en-15-one (PubChem CID 158303057) has the molecular formula C27H46O3Si and a molecular weight of 446.75 g/mol. Its IUPAC name is (1S,4R,5S,6R,7R,8R,9R,10R,12R,14R)-8-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3,6,7,11,11,14-hexamethyltetracyclo[7.5.1.01,5.010,12]pentadec-2-en-15-one.
| Compound Name | (1S,4R,5S,6R,7R,8R,9R,10R,12R,14R)-8-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3,6,7,11,11,14-hexamethyltetracyclo[7.5.1.01,5.010,12]pentadec-2-en-15-one |
|---|---|
| PubChem CID | 158303057 |
| Molecular Formula | C27H46O3Si |
| Molecular Weight | 446.75 g/mol |
| Exact Mass | 446.32 |
| IUPAC Name | (1S,4R,5S,6R,7R,8R,9R,10R,12R,14R)-8-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3,6,7,11,11,14-hexamethyltetracyclo[7.5.1.01,5.010,12]pentadec-2-en-15-one |
| SMILES | CC1=C[C@]23C(=O)[C@@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](C)[C@@H]2[C@H]1O)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C27H46O3Si/c1-14-13-27-15(2)12-18-21(26(18,8)9)19(24(27)29)23(30-31(10,11)25(5,6)7)17(4)16(3)20(27)22(14)28/h13,15-23,28H,12H2,1-11H3/t15-,16-,17-,18-,19-,20-,21-,22+,23-,27-/m1/s1 |
| InChIKey | JVVPLPNIOLXHOL-DHESFCQTSA-N |
| XLogP | 6.08 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.75 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|