C24H29F3N5O3S2- — CID 158303736
2-(4-aminophenyl)-1-[4-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]piperazin-1-yl]ethanone;butane-1-sulfinate (PubChem CID 158303736) has the molecular formula C24H29F3N5O3S2- and a molecular weight of 556.66 g/mol. Its IUPAC name is 2-(4-aminophenyl)-1-[4-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]piperazin-1-yl]ethanone;butane-1-sulfinate.
| Compound Name | 2-(4-aminophenyl)-1-[4-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]piperazin-1-yl]ethanone;butane-1-sulfinate |
|---|---|
| PubChem CID | 158303736 |
| Molecular Formula | C24H29F3N5O3S2- |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | 2-(4-aminophenyl)-1-[4-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]piperazin-1-yl]ethanone;butane-1-sulfinate |
| SMILES | CCCCS(=O)[O-].Nc1ccc(CC(=O)N2CCN(c3ncnc4sc(CC(F)(F)F)cc34)CC2)cc1 |
| InChI | InChI=1S/C20H20F3N5OS.C4H10O2S/c21-20(22,23)11-15-10-16-18(25-12-26-19(16)30-15)28-7-5-27(6-8-28)17(29)9-13-1-3-14(24)4-2-13;1-2-3-4-7(5)6/h1-4,10,12H,5-9,11,24H2;2-4H2,1H3,(H,5,6)/p-1 |
| InChIKey | BCUBXLINTMAZKT-UHFFFAOYSA-M |
| XLogP | 3.94 |
| TPSA | 115.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|