C29H23ClN2O3 — CID 158304173
6-[3-(3-chloro-2-oxopropyl)-4-hydroxyphenyl]-5-methyl-2,3-diphenyl-4H-pyrazolo[1,5-a]pyridin-7-one (PubChem CID 158304173) has the molecular formula C29H23ClN2O3 and a molecular weight of 482.97 g/mol. Its IUPAC name is 6-[3-(3-chloro-2-oxopropyl)-4-hydroxyphenyl]-5-methyl-2,3-diphenyl-4H-pyrazolo[1,5-a]pyridin-7-one.
| Compound Name | 6-[3-(3-chloro-2-oxopropyl)-4-hydroxyphenyl]-5-methyl-2,3-diphenyl-4H-pyrazolo[1,5-a]pyridin-7-one |
|---|---|
| PubChem CID | 158304173 |
| Molecular Formula | C29H23ClN2O3 |
| Molecular Weight | 482.97 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 6-[3-(3-chloro-2-oxopropyl)-4-hydroxyphenyl]-5-methyl-2,3-diphenyl-4H-pyrazolo[1,5-a]pyridin-7-one |
| SMILES | CC1=C(c2ccc(O)c(CC(=O)CCl)c2)C(=O)n2nc(-c3ccccc3)c(-c3ccccc3)c2C1 |
| InChI | InChI=1S/C29H23ClN2O3/c1-18-14-24-27(19-8-4-2-5-9-19)28(20-10-6-3-7-11-20)31-32(24)29(35)26(18)21-12-13-25(34)22(15-21)16-23(33)17-30/h2-13,15,34H,14,16-17H2,1H3 |
| InChIKey | GMWJLISFDVLJMP-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.97 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|