C10H16O2 — CID 15830421
(5R,6R,7Z)-5,6,8-trimethyl-2,3,5,6-tetrahydrooxocin-4-one (PubChem CID 15830421) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (5R,6R,7Z)-5,6,8-trimethyl-2,3,5,6-tetrahydrooxocin-4-one.
| Compound Name | (5R,6R,7Z)-5,6,8-trimethyl-2,3,5,6-tetrahydrooxocin-4-one |
|---|---|
| PubChem CID | 15830421 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (5R,6R,7Z)-5,6,8-trimethyl-2,3,5,6-tetrahydrooxocin-4-one |
| SMILES | C/C1=C/[C@@H](C)[C@@H](C)C(=O)CCO1 |
| InChI | InChI=1S/C10H16O2/c1-7-6-8(2)12-5-4-10(11)9(7)3/h6-7,9H,4-5H2,1-3H3/b8-6-/t7-,9-/m1/s1 |
| InChIKey | CLKCUSVJHLHUIE-IDJYNPRVSA-N |
| XLogP | 2.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |