About 4-bromo-6,6-dimethoxy-2-methylcyclohexa-2,4-dien-1-one
4-bromo-6,6-dimethoxy-2-methylcyclohexa-2,4-dien-1-one (PubChem CID 15830499) has the molecular formula C9H11BrO3
and a molecular weight of 247.09 g/mol. Its IUPAC name is 4-bromo-6,6-dimethoxy-2-methylcyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 4-bromo-6,6-dimethoxy-2-methylcyclohexa-2,4-dien-1-one |
| PubChem CID | 15830499 |
| Molecular Formula | C9H11BrO3 |
| Molecular Weight | 247.09 g/mol |
| Exact Mass | 245.99 |
| IUPAC Name | 4-bromo-6,6-dimethoxy-2-methylcyclohexa-2,4-dien-1-one |
| SMILES | COC1(OC)C=C(Br)C=C(C)C1=O |
| InChI | InChI=1S/C9H11BrO3/c1-6-4-7(10)5-9(12-2,13-3)8(6)11/h4-5H,1-3H3 |
| InChIKey | DJSAYAKJDFJIJI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.09 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-6,6-dimethoxy-2-methylcyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-6,6-dimethoxy-2-methylcyclohexa-2,4-dien-1-one?
The IUPAC name of 4-bromo-6,6-dimethoxy-2-methylcyclohexa-2,4-dien-1-one (CID 15830499) is 4-bromo-6,6-dimethoxy-2-methylcyclohexa-2,4-dien-1-one.
What is the SMILES notation for 4-bromo-6,6-dimethoxy-2-methylcyclohexa-2,4-dien-1-one?
The canonical SMILES for 4-bromo-6,6-dimethoxy-2-methylcyclohexa-2,4-dien-1-one is COC1(OC)C=C(Br)C=C(C)C1=O.
What is the InChIKey of 4-bromo-6,6-dimethoxy-2-methylcyclohexa-2,4-dien-1-one?
The InChIKey is DJSAYAKJDFJIJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrO3/c1-6-4-7(10)5-9(12-2,13-3)8(6)11/h4-5H,1-3H3.
What are the key properties of 4-bromo-6,6-dimethoxy-2-methylcyclohexa-2,4-dien-1-one?
4-bromo-6,6-dimethoxy-2-methylcyclohexa-2,4-dien-1-one has a molecular weight of 247.09 g/mol, XLogP of 1.78, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-6,6-dimethoxy-2-methylcyclohexa-2,4-dien-1-one is sourced from PubChem (CID 15830499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).