C35H58O5 — CID 158305434
6-[(3-methoxyphenyl)methoxy]-2,4,4-trimethylhexan-3-ol;8-(3-methoxyphenyl)-2,4,4-trimethyloctan-3-ol (PubChem CID 158305434) has the molecular formula C35H58O5 and a molecular weight of 558.84 g/mol. Its IUPAC name is 6-[(3-methoxyphenyl)methoxy]-2,4,4-trimethylhexan-3-ol;8-(3-methoxyphenyl)-2,4,4-trimethyloctan-3-ol.
| Compound Name | 6-[(3-methoxyphenyl)methoxy]-2,4,4-trimethylhexan-3-ol;8-(3-methoxyphenyl)-2,4,4-trimethyloctan-3-ol |
|---|---|
| PubChem CID | 158305434 |
| Molecular Formula | C35H58O5 |
| Molecular Weight | 558.84 g/mol |
| Exact Mass | 558.43 |
| IUPAC Name | 6-[(3-methoxyphenyl)methoxy]-2,4,4-trimethylhexan-3-ol;8-(3-methoxyphenyl)-2,4,4-trimethyloctan-3-ol |
| SMILES | COc1cccc(CCCCC(C)(C)C(O)C(C)C)c1.COc1cccc(COCCC(C)(C)C(O)C(C)C)c1 |
| InChI | InChI=1S/C18H30O2.C17H28O3/c1-14(2)17(19)18(3,4)12-7-6-9-15-10-8-11-16(13-15)20-5;1-13(2)16(18)17(3,4)9-10-20-12-14-7-6-8-15(11-14)19-5/h8,10-11,13-14,17,19H,6-7,9,12H2,1-5H3;6-8,11,13,16,18H,9-10,12H2,1-5H3 |
| InChIKey | GNAHWMXZSFTVCG-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.84 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|