About methane;[2-(6-morpholin-4-yl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate
methane;[2-(6-morpholin-4-yl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate (PubChem CID 158307424) has the molecular formula C21H21N5O3S
and a molecular weight of 423.50 g/mol. Its IUPAC name is methane;[2-(6-morpholin-4-yl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate.
Molecular Properties
| Compound Name | methane;[2-(6-morpholin-4-yl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate |
| PubChem CID | 158307424 |
| Molecular Formula | C21H21N5O3S |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | methane;[2-(6-morpholin-4-yl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate |
| SMILES | C.O=COc1csc(-n2nc(-c3ccccc3)c3ccc(N4CCOCC4)nc32)n1 |
| InChI | InChI=1S/C20H17N5O3S.CH4/c26-13-28-17-12-29-20(22-17)25-19-15(18(23-25)14-4-2-1-3-5-14)6-7-16(21-19)24-8-10-27-11-9-24;/h1-7,12-13H,8-11H2;1H4 |
| InChIKey | GNGFVCMUSYXDDH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methane;[2-(6-morpholin-4-yl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;[2-(6-morpholin-4-yl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate?
The IUPAC name of methane;[2-(6-morpholin-4-yl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate (CID 158307424) is methane;[2-(6-morpholin-4-yl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate.
What is the SMILES notation for methane;[2-(6-morpholin-4-yl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate?
The canonical SMILES for methane;[2-(6-morpholin-4-yl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate is C.O=COc1csc(-n2nc(-c3ccccc3)c3ccc(N4CCOCC4)nc32)n1.
What is the InChIKey of methane;[2-(6-morpholin-4-yl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate?
The InChIKey is GNGFVCMUSYXDDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N5O3S.CH4/c26-13-28-17-12-29-20(22-17)25-19-15(18(23-25)14-4-2-1-3-5-14)6-7-16(21-19)24-8-10-27-11-9-24;/h1-7,12-13H,8-11H2;1H4.
What are the key properties of methane;[2-(6-morpholin-4-yl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate?
methane;[2-(6-morpholin-4-yl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate has a molecular weight of 423.50 g/mol, XLogP of 3.55, 5 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methane;[2-(6-morpholin-4-yl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate is sourced from PubChem (CID 158307424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).