About decan-1-ol;dec-9-en-1-ol;trichlororhodium
decan-1-ol;dec-9-en-1-ol;trichlororhodium (PubChem CID 158308896) has the molecular formula C20H42Cl3O2Rh
and a molecular weight of 523.82 g/mol. Its IUPAC name is decan-1-ol;dec-9-en-1-ol;trichlororhodium.
Molecular Properties
| Compound Name | decan-1-ol;dec-9-en-1-ol;trichlororhodium |
| PubChem CID | 158308896 |
| Molecular Formula | C20H42Cl3O2Rh |
| Molecular Weight | 523.82 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | decan-1-ol;dec-9-en-1-ol;trichlororhodium |
| SMILES | C=CCCCCCCCCO.CCCCCCCCCCO.Cl[Rh](Cl)Cl |
| InChI | InChI=1S/C10H22O.C10H20O.3ClH.Rh/c2*1-2-3-4-5-6-7-8-9-10-11;;;;/h11H,2-10H2,1H3;2,11H,1,3-10H2;3*1H;/q;;;;;+3/p-3 |
| InChIKey | GNKXHOLUQGGEKK-UHFFFAOYSA-K |
| XLogP | 8.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 523.82 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze decan-1-ol;dec-9-en-1-ol;trichlororhodium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decan-1-ol;dec-9-en-1-ol;trichlororhodium?
The IUPAC name of decan-1-ol;dec-9-en-1-ol;trichlororhodium (CID 158308896) is decan-1-ol;dec-9-en-1-ol;trichlororhodium.
What is the SMILES notation for decan-1-ol;dec-9-en-1-ol;trichlororhodium?
The canonical SMILES for decan-1-ol;dec-9-en-1-ol;trichlororhodium is C=CCCCCCCCCO.CCCCCCCCCCO.Cl[Rh](Cl)Cl.
What is the InChIKey of decan-1-ol;dec-9-en-1-ol;trichlororhodium?
The InChIKey is GNKXHOLUQGGEKK-UHFFFAOYSA-K. The full InChI is InChI=1S/C10H22O.C10H20O.3ClH.Rh/c2*1-2-3-4-5-6-7-8-9-10-11;;;;/h11H,2-10H2,1H3;2,11H,1,3-10H2;3*1H;/q;;;;;+3/p-3.
What are the key properties of decan-1-ol;dec-9-en-1-ol;trichlororhodium?
decan-1-ol;dec-9-en-1-ol;trichlororhodium has a molecular weight of 523.82 g/mol, XLogP of 8.08, 16 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decan-1-ol;dec-9-en-1-ol;trichlororhodium is sourced from PubChem (CID 158308896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).