C20H21Cl3N4O2 — CID 158309531
2-chloro-5-(1-chloroethyl)pyridine;ethyl 1-[1-(6-chloro-3-pyridinyl)ethyl]pyrazole-4-carboxylate (PubChem CID 158309531) has the molecular formula C20H21Cl3N4O2 and a molecular weight of 455.77 g/mol. Its IUPAC name is 2-chloro-5-(1-chloroethyl)pyridine;ethyl 1-[1-(6-chloro-3-pyridinyl)ethyl]pyrazole-4-carboxylate.
| Compound Name | 2-chloro-5-(1-chloroethyl)pyridine;ethyl 1-[1-(6-chloro-3-pyridinyl)ethyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 158309531 |
| Molecular Formula | C20H21Cl3N4O2 |
| Molecular Weight | 455.77 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | 2-chloro-5-(1-chloroethyl)pyridine;ethyl 1-[1-(6-chloro-3-pyridinyl)ethyl]pyrazole-4-carboxylate |
| SMILES | CC(Cl)c1ccc(Cl)nc1.CCOC(=O)c1cnn(C(C)c2ccc(Cl)nc2)c1 |
| InChI | InChI=1S/C13H14ClN3O2.C7H7Cl2N/c1-3-19-13(18)11-7-16-17(8-11)9(2)10-4-5-12(14)15-6-10;1-5(8)6-2-3-7(9)10-4-6/h4-9H,3H2,1-2H3;2-5H,1H3 |
| InChIKey | GNMVALGLWHHCAA-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.77 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|