C27H44O2Si — CID 158310932
(1S,6R,7R,8R,9R,10R,12R,14R)-8-[tert-butyl(dimethyl)silyl]oxy-3,6,7,11,11,14-hexamethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,4-dien-15-one (PubChem CID 158310932) has the molecular formula C27H44O2Si and a molecular weight of 428.73 g/mol. Its IUPAC name is (1S,6R,7R,8R,9R,10R,12R,14R)-8-[tert-butyl(dimethyl)silyl]oxy-3,6,7,11,11,14-hexamethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,4-dien-15-one.
| Compound Name | (1S,6R,7R,8R,9R,10R,12R,14R)-8-[tert-butyl(dimethyl)silyl]oxy-3,6,7,11,11,14-hexamethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,4-dien-15-one |
|---|---|
| PubChem CID | 158310932 |
| Molecular Formula | C27H44O2Si |
| Molecular Weight | 428.73 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | (1S,6R,7R,8R,9R,10R,12R,14R)-8-[tert-butyl(dimethyl)silyl]oxy-3,6,7,11,11,14-hexamethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,4-dien-15-one |
| SMILES | CC1=C[C@]23C(=O)[C@@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](C)C2=C1)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C27H44O2Si/c1-15-12-19-17(3)18(4)23(29-30(10,11)25(5,6)7)21-22-20(26(22,8)9)13-16(2)27(19,14-15)24(21)28/h12,14,16-18,20-23H,13H2,1-11H3/t16-,17-,18-,20-,21-,22-,23-,27-/m1/s1 |
| InChIKey | LDXVTYWGBBCMJD-WLSBZSHXSA-N |
| XLogP | 7.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.73 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|