C26H19ClF3N5O7S — CID 158311657
methyl 4-chloro-3-nitrobenzoate;methyl 1-methyl-2-[[5-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxylate (PubChem CID 158311657) has the molecular formula C26H19ClF3N5O7S and a molecular weight of 637.98 g/mol. Its IUPAC name is methyl 4-chloro-3-nitrobenzoate;methyl 1-methyl-2-[[5-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxylate.
| Compound Name | methyl 4-chloro-3-nitrobenzoate;methyl 1-methyl-2-[[5-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 158311657 |
| Molecular Formula | C26H19ClF3N5O7S |
| Molecular Weight | 637.98 g/mol |
| Exact Mass | 637.06 |
| IUPAC Name | methyl 4-chloro-3-nitrobenzoate;methyl 1-methyl-2-[[5-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc(Cl)c([N+](=O)[O-])c1.COC(=O)c1ccc2c(c1)nc(Nc1nc3cc(OC(F)(F)F)ccc3s1)n2C |
| InChI | InChI=1S/C18H13F3N4O3S.C8H6ClNO4/c1-25-13-5-3-9(15(26)27-2)7-11(13)22-16(25)24-17-23-12-8-10(28-18(19,20)21)4-6-14(12)29-17;1-14-8(11)5-2-3-6(9)7(4-5)10(12)13/h3-8H,1-2H3,(H,22,23,24);2-4H,1H3 |
| InChIKey | GNTCPMVPQQCZPQ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 147.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.98 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|