About 2-chloro-6-[2-(methoxymethyl)pyrrolidin-1-yl]pyrazine;2,6-dichloropyrazine
2-chloro-6-[2-(methoxymethyl)pyrrolidin-1-yl]pyrazine;2,6-dichloropyrazine (PubChem CID 158311700) has the molecular formula C14H16Cl3N5O
and a molecular weight of 376.68 g/mol. Its IUPAC name is 2-chloro-6-[2-(methoxymethyl)pyrrolidin-1-yl]pyrazine;2,6-dichloropyrazine.
Molecular Properties
| Compound Name | 2-chloro-6-[2-(methoxymethyl)pyrrolidin-1-yl]pyrazine;2,6-dichloropyrazine |
| PubChem CID | 158311700 |
| Molecular Formula | C14H16Cl3N5O |
| Molecular Weight | 376.68 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | 2-chloro-6-[2-(methoxymethyl)pyrrolidin-1-yl]pyrazine;2,6-dichloropyrazine |
| SMILES | COCC1CCCN1c1cncc(Cl)n1.Clc1cncc(Cl)n1 |
| InChI | InChI=1S/C10H14ClN3O.C4H2Cl2N2/c1-15-7-8-3-2-4-14(8)10-6-12-5-9(11)13-10;5-3-1-7-2-4(6)8-3/h5-6,8H,2-4,7H2,1H3;1-2H |
| InChIKey | GNTHIIQVNYUDBW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 64.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.68 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-chloro-6-[2-(methoxymethyl)pyrrolidin-1-yl]pyrazine;2,6-dichloropyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-[2-(methoxymethyl)pyrrolidin-1-yl]pyrazine;2,6-dichloropyrazine?
The IUPAC name of 2-chloro-6-[2-(methoxymethyl)pyrrolidin-1-yl]pyrazine;2,6-dichloropyrazine (CID 158311700) is 2-chloro-6-[2-(methoxymethyl)pyrrolidin-1-yl]pyrazine;2,6-dichloropyrazine.
What is the SMILES notation for 2-chloro-6-[2-(methoxymethyl)pyrrolidin-1-yl]pyrazine;2,6-dichloropyrazine?
The canonical SMILES for 2-chloro-6-[2-(methoxymethyl)pyrrolidin-1-yl]pyrazine;2,6-dichloropyrazine is COCC1CCCN1c1cncc(Cl)n1.Clc1cncc(Cl)n1.
What is the InChIKey of 2-chloro-6-[2-(methoxymethyl)pyrrolidin-1-yl]pyrazine;2,6-dichloropyrazine?
The InChIKey is GNTHIIQVNYUDBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClN3O.C4H2Cl2N2/c1-15-7-8-3-2-4-14(8)10-6-12-5-9(11)13-10;5-3-1-7-2-4(6)8-3/h5-6,8H,2-4,7H2,1H3;1-2H.
What are the key properties of 2-chloro-6-[2-(methoxymethyl)pyrrolidin-1-yl]pyrazine;2,6-dichloropyrazine?
2-chloro-6-[2-(methoxymethyl)pyrrolidin-1-yl]pyrazine;2,6-dichloropyrazine has a molecular weight of 376.68 g/mol, XLogP of 3.53, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-[2-(methoxymethyl)pyrrolidin-1-yl]pyrazine;2,6-dichloropyrazine is sourced from PubChem (CID 158311700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).