C34H38O2 — CID 15831265
(1R,7S,16R,22S)-31,32-dimethylheptacyclo[20.8.1.17,16.03,20.05,18.09,14.024,29]dotriaconta-3,5(18),9,11,13,19,24,26,28-nonaene-31,32-diol (PubChem CID 15831265) has the molecular formula C34H38O2 and a molecular weight of 478.68 g/mol. Its IUPAC name is (1R,7S,16R,22S)-31,32-dimethylheptacyclo[20.8.1.17,16.03,20.05,18.09,14.024,29]dotriaconta-3,5(18),9,11,13,19,24,26,28-nonaene-31,32-diol.
| Compound Name | (1R,7S,16R,22S)-31,32-dimethylheptacyclo[20.8.1.17,16.03,20.05,18.09,14.024,29]dotriaconta-3,5(18),9,11,13,19,24,26,28-nonaene-31,32-diol |
|---|---|
| PubChem CID | 15831265 |
| Molecular Formula | C34H38O2 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | (1R,7S,16R,22S)-31,32-dimethylheptacyclo[20.8.1.17,16.03,20.05,18.09,14.024,29]dotriaconta-3,5(18),9,11,13,19,24,26,28-nonaene-31,32-diol |
| SMILES | CC1(O)[C@@H]2Cc3ccccc3C[C@H]1Cc1cc3c(cc1C2)C[C@@H]1Cc2ccccc2C[C@H](C3)C1(C)O |
| InChI | InChI=1S/C34H38O2/c1-33(35)29-13-21-7-3-4-8-22(21)14-30(33)18-26-12-28-20-32-16-24-10-6-5-9-23(24)15-31(34(32,2)36)19-27(28)11-25(26)17-29/h3-12,29-32,35-36H,13-20H2,1-2H3/t29-,30+,31+,32-,33?,34? |
| InChIKey | OMNYFENRBVQFQJ-KZDFTFDESA-N |
| XLogP | 5.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |