C12H20N6O3S2 — CID 158312972
ethyl 4-methyl-1,3-thiazole-2-carboxylate;hydrazine;4-methyl-1,3-thiazole-2-carbohydrazide (PubChem CID 158312972) has the molecular formula C12H20N6O3S2 and a molecular weight of 360.47 g/mol. Its IUPAC name is ethyl 4-methyl-1,3-thiazole-2-carboxylate;hydrazine;4-methyl-1,3-thiazole-2-carbohydrazide.
| Compound Name | ethyl 4-methyl-1,3-thiazole-2-carboxylate;hydrazine;4-methyl-1,3-thiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 158312972 |
| Molecular Formula | C12H20N6O3S2 |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | ethyl 4-methyl-1,3-thiazole-2-carboxylate;hydrazine;4-methyl-1,3-thiazole-2-carbohydrazide |
| SMILES | CCOC(=O)c1nc(C)cs1.Cc1csc(C(=O)NN)n1.NN |
| InChI | InChI=1S/C7H9NO2S.C5H7N3OS.H4N2/c1-3-10-7(9)6-8-5(2)4-11-6;1-3-2-10-5(7-3)4(9)8-6;1-2/h4H,3H2,1-2H3;2H,6H2,1H3,(H,8,9);1-2H2 |
| InChIKey | GNXBQIMZXBYFNU-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 159.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|