C18H18F3NO5S — CID 158313348
1-[(3R)-5-hydroxy-3-methyl-3-methylsulfonyl-4-oxopentyl]-4-(2,3,4-trifluorophenyl)pyridin-2-one (PubChem CID 158313348) has the molecular formula C18H18F3NO5S and a molecular weight of 417.41 g/mol. Its IUPAC name is 1-[(3R)-5-hydroxy-3-methyl-3-methylsulfonyl-4-oxopentyl]-4-(2,3,4-trifluorophenyl)pyridin-2-one.
| Compound Name | 1-[(3R)-5-hydroxy-3-methyl-3-methylsulfonyl-4-oxopentyl]-4-(2,3,4-trifluorophenyl)pyridin-2-one |
|---|---|
| PubChem CID | 158313348 |
| Molecular Formula | C18H18F3NO5S |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 1-[(3R)-5-hydroxy-3-methyl-3-methylsulfonyl-4-oxopentyl]-4-(2,3,4-trifluorophenyl)pyridin-2-one |
| SMILES | C[C@@](CCn1ccc(-c2ccc(F)c(F)c2F)cc1=O)(C(=O)CO)S(C)(=O)=O |
| InChI | InChI=1S/C18H18F3NO5S/c1-18(14(24)10-23,28(2,26)27)6-8-22-7-5-11(9-15(22)25)12-3-4-13(19)17(21)16(12)20/h3-5,7,9,23H,6,8,10H2,1-2H3/t18-/m1/s1 |
| InChIKey | GNYIPCBIYYCIGM-GOSISDBHSA-N |
| XLogP | 1.69 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|