About CID 158313848
CID 158313848 (PubChem CID 158313848) has the molecular formula C42H65B3BrN6O10
and a molecular weight of 926.35 g/mol.
Molecular Properties
| Compound Name | CID 158313848 |
| PubChem CID | 158313848 |
| Molecular Formula | C42H65B3BrN6O10 |
| Molecular Weight | 926.35 g/mol |
| Exact Mass | 925.42 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O[B]B1OC(C)(C)C(C)(C)O1.CCCCn1c(=O)c2cc(B3OC(C)(C)C(C)(C)O3)cnc2n(C)c1=O.CCCCn1c(=O)c2cc(Br)cnc2n(C)c1=O |
| InChI | InChI=1S/C18H26BN3O4.C12H25B2O4.C12H14BrN3O2/c1-7-8-9-22-15(23)13-10-12(11-20-14(13)21(6)16(22)24)19-25-17(2,3)18(4,5)26-19;1-9(2,15)10(3,4)16-13-14-17-11(5,6)12(7,8)18-14;1-3-4-5-16-11(17)9-6-8(13)7-14-10(9)15(2)12(16)18/h10-11H,7-9H2,1-6H3;15H,1-8H3;6-7H,3-5H2,1-2H3 |
| InChIKey | AIUDSRGAKIBZFQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 180.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 62 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 926.35 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 158313848 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158313848?
The IUPAC name of CID 158313848 (CID 158313848) is not available.
What is the SMILES notation for CID 158313848?
The canonical SMILES for CID 158313848 is CC(C)(O)C(C)(C)O[B]B1OC(C)(C)C(C)(C)O1.CCCCn1c(=O)c2cc(B3OC(C)(C)C(C)(C)O3)cnc2n(C)c1=O.CCCCn1c(=O)c2cc(Br)cnc2n(C)c1=O.
What is the InChIKey of CID 158313848?
The InChIKey is AIUDSRGAKIBZFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26BN3O4.C12H25B2O4.C12H14BrN3O2/c1-7-8-9-22-15(23)13-10-12(11-20-14(13)21(6)16(22)24)19-25-17(2,3)18(4,5)26-19;1-9(2,15)10(3,4)16-13-14-17-11(5,6)12(7,8)18-14;1-3-4-5-16-11(17)9-6-8(13)7-14-10(9)15(2)12(16)18/h10-11H,7-9H2,1-6H3;15H,1-8H3;6-7H,3-5H2,1-2H3.
What are the key properties of CID 158313848?
CID 158313848 has a molecular weight of 926.35 g/mol, XLogP of 4.61, 11 rotatable bonds, 1 hydrogen bond donors, and 16 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158313848 is sourced from PubChem (CID 158313848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).