C18H27NO11S2 — CID 158313936
S-[(3R,3aR,6S,6aS)-3-(methoxymethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] ethanethioate;S-[(3R,3aS,6S,6aS)-3-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] ethanethioate (PubChem CID 158313936) has the molecular formula C18H27NO11S2 and a molecular weight of 497.54 g/mol. Its IUPAC name is S-[(3R,3aR,6S,6aS)-3-(methoxymethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] ethanethioate;S-[(3R,3aS,6S,6aS)-3-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] ethanethioate.
| Compound Name | S-[(3R,3aR,6S,6aS)-3-(methoxymethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] ethanethioate;S-[(3R,3aS,6S,6aS)-3-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] ethanethioate |
|---|---|
| PubChem CID | 158313936 |
| Molecular Formula | C18H27NO11S2 |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | S-[(3R,3aR,6S,6aS)-3-(methoxymethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] ethanethioate;S-[(3R,3aS,6S,6aS)-3-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] ethanethioate |
| SMILES | CC(=O)S[C@H]1CO[C@H]2[C@@H]1OC[C@H]2O[N+](=O)[O-].COCO[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2SC(C)=O |
| InChI | InChI=1S/C10H16O5S.C8H11NO6S/c1-6(11)16-8-4-14-9-7(15-5-12-2)3-13-10(8)9;1-4(10)16-6-3-14-7-5(15-9(11)12)2-13-8(6)7/h7-10H,3-5H2,1-2H3;5-8H,2-3H2,1H3/t7-,8+,9-,10-;5-,6+,7-,8-/m11/s1 |
| InChIKey | GOAFESKFTQORRW-WJNKWRMPSA-N |
| XLogP | 0.43 |
| TPSA | 141.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|