C22H30BBrO2 — CID 158315130
1-(bromomethyl)-4-methylbenzene;4,4,5,5-tetramethyl-2-[(4-methylphenyl)methyl]-1,3,2-dioxaborolane (PubChem CID 158315130) has the molecular formula C22H30BBrO2 and a molecular weight of 417.20 g/mol. Its IUPAC name is 1-(bromomethyl)-4-methylbenzene;4,4,5,5-tetramethyl-2-[(4-methylphenyl)methyl]-1,3,2-dioxaborolane.
| Compound Name | 1-(bromomethyl)-4-methylbenzene;4,4,5,5-tetramethyl-2-[(4-methylphenyl)methyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 158315130 |
| Molecular Formula | C22H30BBrO2 |
| Molecular Weight | 417.20 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 1-(bromomethyl)-4-methylbenzene;4,4,5,5-tetramethyl-2-[(4-methylphenyl)methyl]-1,3,2-dioxaborolane |
| SMILES | Cc1ccc(CB2OC(C)(C)C(C)(C)O2)cc1.Cc1ccc(CBr)cc1 |
| InChI | InChI=1S/C14H21BO2.C8H9Br/c1-11-6-8-12(9-7-11)10-15-16-13(2,3)14(4,5)17-15;1-7-2-4-8(6-9)5-3-7/h6-9H,10H2,1-5H3;2-5H,6H2,1H3 |
| InChIKey | GOEDFJRCRJBOJE-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.20 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|