About 1-bromo-2-fluoro-4-iodobenzene;methyl 6-(4-bromo-3-fluorophenyl)hex-5-ynoate;methyl hex-5-ynoate
1-bromo-2-fluoro-4-iodobenzene;methyl 6-(4-bromo-3-fluorophenyl)hex-5-ynoate;methyl hex-5-ynoate (PubChem CID 158316008) has the molecular formula C26H25Br2F2IO4
and a molecular weight of 726.19 g/mol. Its IUPAC name is 1-bromo-2-fluoro-4-iodobenzene;methyl 6-(4-bromo-3-fluorophenyl)hex-5-ynoate;methyl hex-5-ynoate.
Molecular Properties
| Compound Name | 1-bromo-2-fluoro-4-iodobenzene;methyl 6-(4-bromo-3-fluorophenyl)hex-5-ynoate;methyl hex-5-ynoate |
| PubChem CID | 158316008 |
| Molecular Formula | C26H25Br2F2IO4 |
| Molecular Weight | 726.19 g/mol |
| Exact Mass | 723.91 |
| IUPAC Name | 1-bromo-2-fluoro-4-iodobenzene;methyl 6-(4-bromo-3-fluorophenyl)hex-5-ynoate;methyl hex-5-ynoate |
| SMILES | C#CCCCC(=O)OC.COC(=O)CCCC#Cc1ccc(Br)c(F)c1.Fc1cc(I)ccc1Br |
| InChI | InChI=1S/C13H12BrFO2.C7H10O2.C6H3BrFI/c1-17-13(16)6-4-2-3-5-10-7-8-11(14)12(15)9-10;1-3-4-5-6-7(8)9-2;7-5-2-1-4(9)3-6(5)8/h7-9H,2,4,6H2,1H3;1H,4-6H2,2H3;1-3H |
| InChIKey | GOGPTYHFRDYMQW-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 726.19 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2-fluoro-4-iodobenzene;methyl 6-(4-bromo-3-fluorophenyl)hex-5-ynoate;methyl hex-5-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-fluoro-4-iodobenzene;methyl 6-(4-bromo-3-fluorophenyl)hex-5-ynoate;methyl hex-5-ynoate?
The IUPAC name of 1-bromo-2-fluoro-4-iodobenzene;methyl 6-(4-bromo-3-fluorophenyl)hex-5-ynoate;methyl hex-5-ynoate (CID 158316008) is 1-bromo-2-fluoro-4-iodobenzene;methyl 6-(4-bromo-3-fluorophenyl)hex-5-ynoate;methyl hex-5-ynoate.
What is the SMILES notation for 1-bromo-2-fluoro-4-iodobenzene;methyl 6-(4-bromo-3-fluorophenyl)hex-5-ynoate;methyl hex-5-ynoate?
The canonical SMILES for 1-bromo-2-fluoro-4-iodobenzene;methyl 6-(4-bromo-3-fluorophenyl)hex-5-ynoate;methyl hex-5-ynoate is C#CCCCC(=O)OC.COC(=O)CCCC#Cc1ccc(Br)c(F)c1.Fc1cc(I)ccc1Br.
What is the InChIKey of 1-bromo-2-fluoro-4-iodobenzene;methyl 6-(4-bromo-3-fluorophenyl)hex-5-ynoate;methyl hex-5-ynoate?
The InChIKey is GOGPTYHFRDYMQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BrFO2.C7H10O2.C6H3BrFI/c1-17-13(16)6-4-2-3-5-10-7-8-11(14)12(15)9-10;1-3-4-5-6-7(8)9-2;7-5-2-1-4(9)3-6(5)8/h7-9H,2,4,6H2,1H3;1H,4-6H2,2H3;1-3H.
What are the key properties of 1-bromo-2-fluoro-4-iodobenzene;methyl 6-(4-bromo-3-fluorophenyl)hex-5-ynoate;methyl hex-5-ynoate?
1-bromo-2-fluoro-4-iodobenzene;methyl 6-(4-bromo-3-fluorophenyl)hex-5-ynoate;methyl hex-5-ynoate has a molecular weight of 726.19 g/mol, XLogP of 7.44, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-fluoro-4-iodobenzene;methyl 6-(4-bromo-3-fluorophenyl)hex-5-ynoate;methyl hex-5-ynoate is sourced from PubChem (CID 158316008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).