About pyrrolo[3,2-a]carbazole-1,2-dione
pyrrolo[3,2-a]carbazole-1,2-dione (PubChem CID 158316028) has the molecular formula C14H6N2O2
and a molecular weight of 234.21 g/mol. Its IUPAC name is pyrrolo[3,2-a]carbazole-1,2-dione.
Molecular Properties
| Compound Name | pyrrolo[3,2-a]carbazole-1,2-dione |
| PubChem CID | 158316028 |
| Molecular Formula | C14H6N2O2 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | pyrrolo[3,2-a]carbazole-1,2-dione |
| SMILES | O=c1nc2ccc3c4ccccc4nc3c2c1=O |
| InChI | InChI=1S/C14H6N2O2/c17-13-11-10(16-14(13)18)6-5-8-7-3-1-2-4-9(7)15-12(8)11/h1-6H |
| InChIKey | GOGROEBAOFJELP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze pyrrolo[3,2-a]carbazole-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolo[3,2-a]carbazole-1,2-dione?
The IUPAC name of pyrrolo[3,2-a]carbazole-1,2-dione (CID 158316028) is pyrrolo[3,2-a]carbazole-1,2-dione.
What is the SMILES notation for pyrrolo[3,2-a]carbazole-1,2-dione?
The canonical SMILES for pyrrolo[3,2-a]carbazole-1,2-dione is O=c1nc2ccc3c4ccccc4nc3c2c1=O.
What is the InChIKey of pyrrolo[3,2-a]carbazole-1,2-dione?
The InChIKey is GOGROEBAOFJELP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H6N2O2/c17-13-11-10(16-14(13)18)6-5-8-7-3-1-2-4-9(7)15-12(8)11/h1-6H.
What are the key properties of pyrrolo[3,2-a]carbazole-1,2-dione?
pyrrolo[3,2-a]carbazole-1,2-dione has a molecular weight of 234.21 g/mol, XLogP of 1.53, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolo[3,2-a]carbazole-1,2-dione is sourced from PubChem (CID 158316028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).