C34H40F3N6O2+ — CID 158316052
bis(2-aminoethyl)-[4-[(2S)-2-amino-3-oxo-3-[[(2S)-3-oxo-4-quinolin-3-yl-1-[4-(trifluoromethyl)phenyl]butan-2-yl]amino]propyl]phenyl]-methylazanium (PubChem CID 158316052) has the molecular formula C34H40F3N6O2+ and a molecular weight of 621.73 g/mol. Its IUPAC name is bis(2-aminoethyl)-[4-[(2S)-2-amino-3-oxo-3-[[(2S)-3-oxo-4-quinolin-3-yl-1-[4-(trifluoromethyl)phenyl]butan-2-yl]amino]propyl]phenyl]-methylazanium.
| Compound Name | bis(2-aminoethyl)-[4-[(2S)-2-amino-3-oxo-3-[[(2S)-3-oxo-4-quinolin-3-yl-1-[4-(trifluoromethyl)phenyl]butan-2-yl]amino]propyl]phenyl]-methylazanium |
|---|---|
| PubChem CID | 158316052 |
| Molecular Formula | C34H40F3N6O2+ |
| Molecular Weight | 621.73 g/mol |
| Exact Mass | 621.32 |
| IUPAC Name | bis(2-aminoethyl)-[4-[(2S)-2-amino-3-oxo-3-[[(2S)-3-oxo-4-quinolin-3-yl-1-[4-(trifluoromethyl)phenyl]butan-2-yl]amino]propyl]phenyl]-methylazanium |
| SMILES | C[N+](CCN)(CCN)c1ccc(C[C@H](N)C(=O)N[C@@H](Cc2ccc(C(F)(F)F)cc2)C(=O)Cc2cnc3ccccc3c2)cc1 |
| InChI | InChI=1S/C34H39F3N6O2/c1-43(16-14-38,17-15-39)28-12-8-23(9-13-28)19-29(40)33(45)42-31(20-24-6-10-27(11-7-24)34(35,36)37)32(44)21-25-18-26-4-2-3-5-30(26)41-22-25/h2-13,18,22,29,31H,14-17,19-21,38-40H2,1H3/p+1/t29-,31-/m0/s1 |
| InChIKey | DPIJZOZYMPEFNH-SMCANUKXSA-O |
| XLogP | 3.52 |
| TPSA | 137.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.73 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|