C8H16ClNO6 — CID 158316677
dideuterio (3S)-2,2,3-trideuterio-3-deuteriooxybutanedioate;(3S)-2,2,3,4,4,5,5-heptadeuteriopyrrolidin-3-ol;hydrochloride (PubChem CID 158316677) has the molecular formula C8H16ClNO6 and a molecular weight of 270.75 g/mol. Its IUPAC name is dideuterio (3S)-2,2,3-trideuterio-3-deuteriooxybutanedioate;(3S)-2,2,3,4,4,5,5-heptadeuteriopyrrolidin-3-ol;hydrochloride.
| Compound Name | dideuterio (3S)-2,2,3-trideuterio-3-deuteriooxybutanedioate;(3S)-2,2,3,4,4,5,5-heptadeuteriopyrrolidin-3-ol;hydrochloride |
|---|---|
| PubChem CID | 158316677 |
| Molecular Formula | C8H16ClNO6 |
| Molecular Weight | 270.75 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | dideuterio (3S)-2,2,3-trideuterio-3-deuteriooxybutanedioate;(3S)-2,2,3,4,4,5,5-heptadeuteriopyrrolidin-3-ol;hydrochloride |
| SMILES | Cl.[2H]C1([2H])NC([2H])([2H])[C@@]([2H])(O)C1([2H])[2H].[2H]OC(=O)C([2H])([2H])[C@]([2H])(O[2H])C(=O)O[2H] |
| InChI | InChI=1S/C4H9NO.C4H6O5.ClH/c6-4-1-2-5-3-4;5-2(4(8)9)1-3(6)7;/h4-6H,1-3H2;2,5H,1H2,(H,6,7)(H,8,9);1H/t4-;2-;/m00./s1/i1D2,2D2,3D2,4D;1D2,2D,5D;/hD2 |
| InChIKey | UCMPGFXDWSEDKS-HPTDSIDTSA-N |
| XLogP | -1.33 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.75 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |