C22H22FN3O — CID 158316811
1-[3-(1-amino-3-methyl-4H-2,6-naphthyridin-3-yl)-4-fluorophenyl]hept-3-yn-2-one (PubChem CID 158316811) has the molecular formula C22H22FN3O and a molecular weight of 363.44 g/mol. Its IUPAC name is 1-[3-(1-amino-3-methyl-4H-2,6-naphthyridin-3-yl)-4-fluorophenyl]hept-3-yn-2-one.
| Compound Name | 1-[3-(1-amino-3-methyl-4H-2,6-naphthyridin-3-yl)-4-fluorophenyl]hept-3-yn-2-one |
|---|---|
| PubChem CID | 158316811 |
| Molecular Formula | C22H22FN3O |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 1-[3-(1-amino-3-methyl-4H-2,6-naphthyridin-3-yl)-4-fluorophenyl]hept-3-yn-2-one |
| SMILES | CCCC#CC(=O)Cc1ccc(F)c(C2(C)Cc3cnccc3C(N)=N2)c1 |
| InChI | InChI=1S/C22H22FN3O/c1-3-4-5-6-17(27)11-15-7-8-20(23)19(12-15)22(2)13-16-14-25-10-9-18(16)21(24)26-22/h7-10,12,14H,3-4,11,13H2,1-2H3,(H2,24,26) |
| InChIKey | GOIYKZAHELMBGG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|