About benzene;1-methyl-2-phenylindole
benzene;1-methyl-2-phenylindole (PubChem CID 158316839) has the molecular formula C21H19N
and a molecular weight of 285.39 g/mol. Its IUPAC name is benzene;1-methyl-2-phenylindole.
Molecular Properties
| Compound Name | benzene;1-methyl-2-phenylindole |
| PubChem CID | 158316839 |
| Molecular Formula | C21H19N |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | benzene;1-methyl-2-phenylindole |
| SMILES | Cn1c(-c2ccccc2)cc2ccccc21.c1ccccc1 |
| InChI | InChI=1S/C15H13N.C6H6/c1-16-14-10-6-5-9-13(14)11-15(16)12-7-3-2-4-8-12;1-2-4-6-5-3-1/h2-11H,1H3;1-6H |
| InChIKey | GOJAIGCNEIJFKQ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzene;1-methyl-2-phenylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;1-methyl-2-phenylindole?
The IUPAC name of benzene;1-methyl-2-phenylindole (CID 158316839) is benzene;1-methyl-2-phenylindole.
What is the SMILES notation for benzene;1-methyl-2-phenylindole?
The canonical SMILES for benzene;1-methyl-2-phenylindole is Cn1c(-c2ccccc2)cc2ccccc21.c1ccccc1.
What is the InChIKey of benzene;1-methyl-2-phenylindole?
The InChIKey is GOJAIGCNEIJFKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N.C6H6/c1-16-14-10-6-5-9-13(14)11-15(16)12-7-3-2-4-8-12;1-2-4-6-5-3-1/h2-11H,1H3;1-6H.
What are the key properties of benzene;1-methyl-2-phenylindole?
benzene;1-methyl-2-phenylindole has a molecular weight of 285.39 g/mol, XLogP of 5.53, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;1-methyl-2-phenylindole is sourced from PubChem (CID 158316839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).