About 1-amino-3-(3,4-dichlorophenyl)propane-2-thione
1-amino-3-(3,4-dichlorophenyl)propane-2-thione (PubChem CID 158316873) has the molecular formula C9H9Cl2NS
and a molecular weight of 234.15 g/mol. Its IUPAC name is 1-amino-3-(3,4-dichlorophenyl)propane-2-thione.
Molecular Properties
| Compound Name | 1-amino-3-(3,4-dichlorophenyl)propane-2-thione |
| PubChem CID | 158316873 |
| Molecular Formula | C9H9Cl2NS |
| Molecular Weight | 234.15 g/mol |
| Exact Mass | 232.98 |
| IUPAC Name | 1-amino-3-(3,4-dichlorophenyl)propane-2-thione |
| SMILES | NCC(=S)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H9Cl2NS/c10-8-2-1-6(4-9(8)11)3-7(13)5-12/h1-2,4H,3,5,12H2 |
| InChIKey | CTSYQPULJDXVOC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.15 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-(3,4-dichlorophenyl)propane-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-(3,4-dichlorophenyl)propane-2-thione?
The IUPAC name of 1-amino-3-(3,4-dichlorophenyl)propane-2-thione (CID 158316873) is 1-amino-3-(3,4-dichlorophenyl)propane-2-thione.
What is the SMILES notation for 1-amino-3-(3,4-dichlorophenyl)propane-2-thione?
The canonical SMILES for 1-amino-3-(3,4-dichlorophenyl)propane-2-thione is NCC(=S)Cc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 1-amino-3-(3,4-dichlorophenyl)propane-2-thione?
The InChIKey is CTSYQPULJDXVOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Cl2NS/c10-8-2-1-6(4-9(8)11)3-7(13)5-12/h1-2,4H,3,5,12H2.
What are the key properties of 1-amino-3-(3,4-dichlorophenyl)propane-2-thione?
1-amino-3-(3,4-dichlorophenyl)propane-2-thione has a molecular weight of 234.15 g/mol, XLogP of 2.86, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-(3,4-dichlorophenyl)propane-2-thione is sourced from PubChem (CID 158316873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).